C21H22FN3O3S — CID 135706442
2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]-N-[(2-fluorophenyl)methyl]acetamide (PubChem CID 135706442) has the molecular formula C21H22FN3O3S and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]-N-[(2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]-N-[(2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 135706442 |
| Molecular Formula | C21H22FN3O3S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-[[4-ethyl-5-(4-methylphenyl)-1,1-dioxo-1,2-thiazol-3-ylidene]amino]-N-[(2-fluorophenyl)methyl]acetamide |
| SMILES | CCC1=C(c2ccc(C)cc2)S(=O)(=O)N/C1=N\CC(=O)NCc1ccccc1F |
| InChI | InChI=1S/C21H22FN3O3S/c1-3-17-20(15-10-8-14(2)9-11-15)29(27,28)25-21(17)24-13-19(26)23-12-16-6-4-5-7-18(16)22/h4-11H,3,12-13H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | CGRUFKMWFXMRPC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|