C13H12N4OS — CID 135707237
(2E)-2-[(E)-1H-indol-3-ylmethylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one (PubChem CID 135707237) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is (2E)-2-[(E)-1H-indol-3-ylmethylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-1H-indol-3-ylmethylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135707237 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (2E)-2-[(E)-1H-indol-3-ylmethylidenehydrazinylidene]-5-methyl-1,3-thiazolidin-4-one |
| SMILES | CC1S/C(=N/N=C/c2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C13H12N4OS/c1-8-12(18)16-13(19-8)17-15-7-9-6-14-11-5-3-2-4-10(9)11/h2-8,14H,1H3,(H,16,17,18)/b15-7+ |
| InChIKey | LGVCUHHQXHLJQL-VIZOYTHASA-N |
| XLogP | 2.11 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|