C18H19N3OS — CID 135707304
(2Z)-5-[(3,4-dimethylphenyl)methyl]-2-[(3-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one (PubChem CID 135707304) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is (2Z)-5-[(3,4-dimethylphenyl)methyl]-2-[(3-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-5-[(3,4-dimethylphenyl)methyl]-2-[(3-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135707304 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2Z)-5-[(3,4-dimethylphenyl)methyl]-2-[(3-methyl-2-pyridinyl)imino]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(CC2S/C(=N\c3ncccc3C)NC2=O)cc1C |
| InChI | InChI=1S/C18H19N3OS/c1-11-6-7-14(9-13(11)3)10-15-17(22)21-18(23-15)20-16-12(2)5-4-8-19-16/h4-9,15H,10H2,1-3H3,(H,19,20,21,22) |
| InChIKey | VSHWMDZXVFCLEL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|