C28H27NO3S — CID 135707658
(Z,1S,2R,3R)-2-ethenyl-7-(4-hydroxynaphthalen-1-yl)-6-pyridin-2-yl-1-thiophen-2-ylhept-6-ene-1,3-diol (PubChem CID 135707658) has the molecular formula C28H27NO3S and a molecular weight of 457.60 g/mol. Its IUPAC name is (Z,1S,2R,3R)-2-ethenyl-7-(4-hydroxynaphthalen-1-yl)-6-pyridin-2-yl-1-thiophen-2-ylhept-6-ene-1,3-diol.
| Compound Name | (Z,1S,2R,3R)-2-ethenyl-7-(4-hydroxynaphthalen-1-yl)-6-pyridin-2-yl-1-thiophen-2-ylhept-6-ene-1,3-diol |
|---|---|
| PubChem CID | 135707658 |
| Molecular Formula | C28H27NO3S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (Z,1S,2R,3R)-2-ethenyl-7-(4-hydroxynaphthalen-1-yl)-6-pyridin-2-yl-1-thiophen-2-ylhept-6-ene-1,3-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccc(O)c2ccccc12)c1ccccn1)[C@H](O)c1cccs1 |
| InChI | InChI=1S/C28H27NO3S/c1-2-21(28(32)27-11-7-17-33-27)25(30)15-13-20(24-10-5-6-16-29-24)18-19-12-14-26(31)23-9-4-3-8-22(19)23/h2-12,14,16-18,21,25,28,30-32H,1,13,15H2/b20-18-/t21-,25-,28+/m1/s1 |
| InChIKey | JIVWJXQBLWRSGB-DFHDDLNOSA-N |
| XLogP | 6.22 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|