C11H14N3O3- — CID 135708180
1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-4-carboxylate (PubChem CID 135708180) has the molecular formula C11H14N3O3- and a molecular weight of 236.25 g/mol. Its IUPAC name is 1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-4-carboxylate.
| Compound Name | 1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 135708180 |
| Molecular Formula | C11H14N3O3- |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 1-(4-methyl-6-oxo-1H-pyrimidin-2-yl)piperidine-4-carboxylate |
| SMILES | Cc1cc(=O)[nH]c(N2CCC(C(=O)[O-])CC2)n1 |
| InChI | InChI=1S/C11H15N3O3/c1-7-6-9(15)13-11(12-7)14-4-2-8(3-5-14)10(16)17/h6,8H,2-5H2,1H3,(H,16,17)(H,12,13,15)/p-1 |
| InChIKey | ZFFCTRRQTOQPMC-UHFFFAOYSA-M |
| XLogP | -0.96 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |