C22H22N2O4S — CID 135708622
(5E)-5-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 135708622) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is (5E)-5-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135708622 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (5E)-5-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cc(/C=C2/S/C(=N\c3ccc(OC)cc3)NC2=O)cc(OCC)c1O |
| InChI | InChI=1S/C22H22N2O4S/c1-4-6-15-11-14(12-18(20(15)25)28-5-2)13-19-21(26)24-22(29-19)23-16-7-9-17(27-3)10-8-16/h4,7-13,25H,1,5-6H2,2-3H3,(H,23,24,26)/b19-13+ |
| InChIKey | BOWHMLZCZGZPBR-CPNJWEJPSA-N |
| XLogP | 4.42 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|