C9H13N5O3S2 — CID 135709800
4-N-methyl-3-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine (PubChem CID 135709800) has the molecular formula C9H13N5O3S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 4-N-methyl-3-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine.
| Compound Name | 4-N-methyl-3-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine |
|---|---|
| PubChem CID | 135709800 |
| Molecular Formula | C9H13N5O3S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 4-N-methyl-3-N-[2-(1,2-oxazol-3-ylmethylsulfanyl)ethyl]-1,1-dioxo-1,2,5-thiadiazolidine-3,4-diimine |
| SMILES | C/N=C1\NS(=O)(=O)N\C1=N\CCSCc1ccon1 |
| InChI | InChI=1S/C9H13N5O3S2/c1-10-8-9(14-19(15,16)13-8)11-3-5-18-6-7-2-4-17-12-7/h2,4H,3,5-6H2,1H3,(H,10,13)(H,11,14) |
| InChIKey | PRJYTSQBFUVSQR-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|