C19H21ClN2O6 — CID 135710501
N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3,4,5-trimethoxybenzamide (PubChem CID 135710501) has the molecular formula C19H21ClN2O6 and a molecular weight of 408.84 g/mol. Its IUPAC name is N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 135710501 |
| Molecular Formula | C19H21ClN2O6 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-[(E)-(3-chloro-5-ethoxy-4-hydroxyphenyl)methylideneamino]-3,4,5-trimethoxybenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2cc(OC)c(OC)c(OC)c2)cc(Cl)c1O |
| InChI | InChI=1S/C19H21ClN2O6/c1-5-28-14-7-11(6-13(20)17(14)23)10-21-22-19(24)12-8-15(25-2)18(27-4)16(9-12)26-3/h6-10,23H,5H2,1-4H3,(H,22,24)/b21-10+ |
| InChIKey | DIZBLIADRLRNMM-UFFVCSGVSA-N |
| XLogP | 3.23 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|