C12H13N3O — CID 135711148
3,7-dimethyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one (PubChem CID 135711148) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 3,7-dimethyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one.
| Compound Name | 3,7-dimethyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
|---|---|
| PubChem CID | 135711148 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3,7-dimethyl-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-2-one |
| SMILES | Cc1ccc2c(c1)CN1C(=N2)NC(=O)C1C |
| InChI | InChI=1S/C12H13N3O/c1-7-3-4-10-9(5-7)6-15-8(2)11(16)14-12(15)13-10/h3-5,8H,6H2,1-2H3,(H,13,14,16) |
| InChIKey | HPCUPARCKXNYFX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |