About (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol
(2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol (PubChem CID 135711437) has the molecular formula C20H16N4OS
and a molecular weight of 360.44 g/mol. Its IUPAC name is (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol |
| PubChem CID | 135711437 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol |
| SMILES | C=CCn1c(O)c(/C=C2\C=Nc3ccccc32)s/c1=N/c1ccccn1 |
| InChI | InChI=1S/C20H16N4OS/c1-2-11-24-19(25)17(26-20(24)23-18-9-5-6-10-21-18)12-14-13-22-16-8-4-3-7-15(14)16/h2-10,12-13,25H,1,11H2/b14-12+,23-20+ |
| InChIKey | DXQCTFBQBFPWDA-SGJIEQFKSA-N |
| XLogP | 4.33 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol?
The IUPAC name of (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol (CID 135711437) is (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol.
What is the SMILES notation for (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol?
The canonical SMILES for (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol is C=CCn1c(O)c(/C=C2\C=Nc3ccccc32)s/c1=N/c1ccccn1.
What is the InChIKey of (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol?
The InChIKey is DXQCTFBQBFPWDA-SGJIEQFKSA-N. The full InChI is InChI=1S/C20H16N4OS/c1-2-11-24-19(25)17(26-20(24)23-18-9-5-6-10-21-18)12-14-13-22-16-8-4-3-7-15(14)16/h2-10,12-13,25H,1,11H2/b14-12+,23-20+.
What are the key properties of (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol?
(2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol has a molecular weight of 360.44 g/mol, XLogP of 4.33, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-5-[(Z)-indol-3-ylidenemethyl]-3-prop-2-enyl-2-pyridin-2-ylimino-1,3-thiazol-4-ol is sourced from PubChem (CID 135711437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).