About 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one
5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one (PubChem CID 135711527) has the molecular formula C15H9BrN4O2S2
and a molecular weight of 421.30 g/mol. Its IUPAC name is 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one.
Molecular Properties
| Compound Name | 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one |
| PubChem CID | 135711527 |
| Molecular Formula | C15H9BrN4O2S2 |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 419.94 |
| IUPAC Name | 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one |
| SMILES | Cn1c(O)c(C2=c3cc(Br)ccc3=NC2=O)s/c1=N/c1nccs1 |
| InChI | InChI=1S/C15H9BrN4O2S2/c1-20-13(22)11(24-15(20)19-14-17-4-5-23-14)10-8-6-7(16)2-3-9(8)18-12(10)21/h2-6,22H,1H3/b19-15+ |
| InChIKey | KRURWVYKHPDINA-XDJHFCHBSA-N |
| XLogP | 1.60 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one?
The IUPAC name of 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one (CID 135711527) is 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one.
What is the SMILES notation for 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one?
The canonical SMILES for 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one is Cn1c(O)c(C2=c3cc(Br)ccc3=NC2=O)s/c1=N/c1nccs1.
What is the InChIKey of 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one?
The InChIKey is KRURWVYKHPDINA-XDJHFCHBSA-N. The full InChI is InChI=1S/C15H9BrN4O2S2/c1-20-13(22)11(24-15(20)19-14-17-4-5-23-14)10-8-6-7(16)2-3-9(8)18-12(10)21/h2-6,22H,1H3/b19-15+.
What are the key properties of 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one?
5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one has a molecular weight of 421.30 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-[(2E)-4-hydroxy-3-methyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-5-yl]indol-2-one is sourced from PubChem (CID 135711527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).