C10H7F3N2OS — CID 135711801
4-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-2-one (PubChem CID 135711801) has the molecular formula C10H7F3N2OS and a molecular weight of 260.24 g/mol. Its IUPAC name is 4-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-2-one.
| Compound Name | 4-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 135711801 |
| Molecular Formula | C10H7F3N2OS |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 4-[3-(trifluoromethyl)phenyl]imino-1,3-thiazolidin-2-one |
| SMILES | O=C1N/C(=N/c2cccc(C(F)(F)F)c2)CS1 |
| InChI | InChI=1S/C10H7F3N2OS/c11-10(12,13)6-2-1-3-7(4-6)14-8-5-17-9(16)15-8/h1-4H,5H2,(H,14,15,16) |
| InChIKey | ISJLJLAEQDNHGZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|