C25H24FN3O3S — CID 135712316
2-[(4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-(5-methylfuran-2-yl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135712316) has the molecular formula C25H24FN3O3S and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-(5-methylfuran-2-yl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-(5-methylfuran-2-yl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135712316 |
| Molecular Formula | C25H24FN3O3S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-(5-methylfuran-2-yl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccc(F)cc4)[nH]c(=O)c32)o1 |
| InChI | InChI=1S/C25H24FN3O3S/c1-13-4-9-18(32-13)20-19-16(10-25(2,3)11-17(19)30)27-22-21(20)23(31)29-24(28-22)33-12-14-5-7-15(26)8-6-14/h4-9,20H,10-12H2,1-3H3,(H2,27,28,29,31) |
| InChIKey | XWSUTYVBZBRNKK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |