About 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol
5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol (PubChem CID 135712520) has the molecular formula C16H13N5OS
and a molecular weight of 323.38 g/mol. Its IUPAC name is 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol.
Molecular Properties
| Compound Name | 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol |
| PubChem CID | 135712520 |
| Molecular Formula | C16H13N5OS |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol |
| SMILES | Oc1nc(NCc2cccs2)[nH]c1/C=C1\C=Nc2ncccc21 |
| InChI | InChI=1S/C16H13N5OS/c22-15-13(7-10-8-18-14-12(10)4-1-5-17-14)20-16(21-15)19-9-11-3-2-6-23-11/h1-8,22H,9H2,(H2,19,20,21)/b10-7+ |
| InChIKey | SHSMPGJQQXAUMA-JXMROGBWSA-N |
| XLogP | 3.44 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol?
The IUPAC name of 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol (CID 135712520) is 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol.
What is the SMILES notation for 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol?
The canonical SMILES for 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol is Oc1nc(NCc2cccs2)[nH]c1/C=C1\C=Nc2ncccc21.
What is the InChIKey of 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol?
The InChIKey is SHSMPGJQQXAUMA-JXMROGBWSA-N. The full InChI is InChI=1S/C16H13N5OS/c22-15-13(7-10-8-18-14-12(10)4-1-5-17-14)20-16(21-15)19-9-11-3-2-6-23-11/h1-8,22H,9H2,(H2,19,20,21)/b10-7+.
What are the key properties of 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol?
5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol has a molecular weight of 323.38 g/mol, XLogP of 3.44, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(Z)-pyrrolo[2,3-b]pyridin-3-ylidenemethyl]-2-(thiophen-2-ylmethylamino)-1H-imidazol-4-ol is sourced from PubChem (CID 135712520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).