About 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one
4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135712905) has the molecular formula C14H12ClN3O
and a molecular weight of 273.72 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| PubChem CID | 135712905 |
| Molecular Formula | C14H12ClN3O |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | Cc1nn(C)c2[nH]c(=O)cc(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C14H12ClN3O/c1-8-13-11(9-3-5-10(15)6-4-9)7-12(19)16-14(13)18(2)17-8/h3-7H,1-2H3,(H,16,19) |
| InChIKey | DYVPQHGXOHRONE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The IUPAC name of 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (CID 135712905) is 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one.
What is the SMILES notation for 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The canonical SMILES for 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one is Cc1nn(C)c2[nH]c(=O)cc(-c3ccc(Cl)cc3)c12.
What is the InChIKey of 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The InChIKey is DYVPQHGXOHRONE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClN3O/c1-8-13-11(9-3-5-10(15)6-4-9)7-12(19)16-14(13)18(2)17-8/h3-7H,1-2H3,(H,16,19).
What are the key properties of 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one?
4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one has a molecular weight of 273.72 g/mol, XLogP of 2.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-1,3-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one is sourced from PubChem (CID 135712905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).