C9H8N4O — CID 135712912
4-(6-Methyl-1,2,4,5-tetrazin-3-yl)phenol (PubChem CID 135712912) has the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. Its IUPAC name is 4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenol.
| Compound Name | 4-(6-Methyl-1,2,4,5-tetrazin-3-yl)phenol |
|---|---|
| PubChem CID | 135712912 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenol |
| SMILES | CC1=NN=C(N=N1)C2=CC=C(C=C2)O |
| InChI | InChI=1S/C9H8N4O/c1-6-10-12-9(13-11-6)7-2-4-8(14)5-3-7/h2-5,14H,1H3 |
| InChIKey | WQYZHGNJBULAME-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 71.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 174 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |