C25H21N5O4S — CID 135713273
4-[[3-[(2,3-dihydroxyphenyl)methylideneamino]-4-(furan-2-yl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 135713273) has the molecular formula C25H21N5O4S and a molecular weight of 487.54 g/mol. Its IUPAC name is 4-[[3-[(2,3-dihydroxyphenyl)methylideneamino]-4-(furan-2-yl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-[(2,3-dihydroxyphenyl)methylideneamino]-4-(furan-2-yl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 135713273 |
| Molecular Formula | C25H21N5O4S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 4-[[3-[(2,3-dihydroxyphenyl)methylideneamino]-4-(furan-2-yl)-1,3-thiazol-2-ylidene]amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=c2\scc(-c3ccco3)n2N=Cc2cccc(O)c2O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H21N5O4S/c1-16-22(24(33)30(28(16)2)18-9-4-3-5-10-18)27-25-29(19(15-35-25)21-12-7-13-34-21)26-14-17-8-6-11-20(31)23(17)32/h3-15,31-32H,1-2H3/b26-14?,27-25- |
| InChIKey | KQCXLAOZOQQUGR-ZMERXUEGSA-N |
| XLogP | 4.13 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|