About diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride
diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride (PubChem CID 135713866) has the molecular formula C8H10Cl3N3O
and a molecular weight of 270.55 g/mol. Its IUPAC name is diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride.
Molecular Properties
| Compound Name | diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride |
| PubChem CID | 135713866 |
| Molecular Formula | C8H10Cl3N3O |
| Molecular Weight | 270.55 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride |
| SMILES | NC(N)=[NH+]OCc1c(Cl)cccc1Cl.[Cl-] |
| InChI | InChI=1S/C8H9Cl2N3O.ClH/c9-6-2-1-3-7(10)5(6)4-14-13-8(11)12;/h1-3H,4H2,(H4,11,12,13);1H |
| InChIKey | PBTNNSBEDLXNCS-UHFFFAOYSA-N |
| XLogP | -3.22 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.55 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride?
The IUPAC name of diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride (CID 135713866) is diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride.
What is the SMILES notation for diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride?
The canonical SMILES for diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride is NC(N)=[NH+]OCc1c(Cl)cccc1Cl.[Cl-].
What is the InChIKey of diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride?
The InChIKey is PBTNNSBEDLXNCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl2N3O.ClH/c9-6-2-1-3-7(10)5(6)4-14-13-8(11)12;/h1-3H,4H2,(H4,11,12,13);1H.
What are the key properties of diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride?
diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride has a molecular weight of 270.55 g/mol, XLogP of -3.22, 3 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diaminomethylidene-[(2,6-dichlorophenyl)methoxy]azanium chloride is sourced from PubChem (CID 135713866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).