About 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one
2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 135714100) has the molecular formula C18H15N3OS2
and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| PubChem CID | 135714100 |
| Molecular Formula | C18H15N3OS2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | Cc1cc(SCc2nc3ccsc3c(=O)[nH]2)nc2c(C)cccc12 |
| InChI | InChI=1S/C18H15N3OS2/c1-10-4-3-5-12-11(2)8-15(21-16(10)12)24-9-14-19-13-6-7-23-17(13)18(22)20-14/h3-8H,9H2,1-2H3,(H,19,20,22) |
| InChIKey | BSEYFLIDKOVQHN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one?
The IUPAC name of 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one (CID 135714100) is 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one.
What is the SMILES notation for 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one?
The canonical SMILES for 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one is Cc1cc(SCc2nc3ccsc3c(=O)[nH]2)nc2c(C)cccc12.
What is the InChIKey of 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one?
The InChIKey is BSEYFLIDKOVQHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3OS2/c1-10-4-3-5-12-11(2)8-15(21-16(10)12)24-9-14-19-13-6-7-23-17(13)18(22)20-14/h3-8H,9H2,1-2H3,(H,19,20,22).
What are the key properties of 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one?
2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one has a molecular weight of 353.47 g/mol, XLogP of 4.44, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,8-dimethylquinolin-2-yl)sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one is sourced from PubChem (CID 135714100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).