C30H41N11O3 — CID 135714538
5-[[1-[[4-[[4-[3-(dibutylamino)propylamino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]-2-oxopropyl]amino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 135714538) has the molecular formula C30H41N11O3 and a molecular weight of 603.73 g/mol. Its IUPAC name is 5-[[1-[[4-[[4-[3-(dibutylamino)propylamino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]-2-oxopropyl]amino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[[1-[[4-[[4-[3-(dibutylamino)propylamino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]-2-oxopropyl]amino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 135714538 |
| Molecular Formula | C30H41N11O3 |
| Molecular Weight | 603.73 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | 5-[[1-[[4-[[4-[3-(dibutylamino)propylamino]-6-oxo-1H-1,3,5-triazin-2-yl]amino]phenyl]diazenyl]-2-oxopropyl]amino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CCCCN(CCCC)CCCNc1nc(Nc2ccc(/N=N/C(Nc3ccc4[nH]c(=O)[nH]c4c3)C(C)=O)cc2)[nH]c(=O)n1 |
| InChI | InChI=1S/C30H41N11O3/c1-4-6-16-41(17-7-5-2)18-8-15-31-27-36-28(38-30(44)37-27)33-21-9-11-22(12-10-21)39-40-26(20(3)42)32-23-13-14-24-25(19-23)35-29(43)34-24/h9-14,19,26,32H,4-8,15-18H2,1-3H3,(H2,34,35,43)(H3,31,33,36,37,38,44)/b40-39+ |
| InChIKey | FYMLJCHEBWGLLB-XQQUEIPISA-N |
| XLogP | 4.89 |
| TPSA | 188.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.73 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|