C18H20N4O2 — CID 135715228
8,8-dimethyl-5-(4-methylphenyl)-5,7,9,10-tetrahydro-4H-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one (PubChem CID 135715228) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 8,8-dimethyl-5-(4-methylphenyl)-5,7,9,10-tetrahydro-4H-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one.
| Compound Name | 8,8-dimethyl-5-(4-methylphenyl)-5,7,9,10-tetrahydro-4H-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 135715228 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 8,8-dimethyl-5-(4-methylphenyl)-5,7,9,10-tetrahydro-4H-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
| SMILES | Cc1ccc(C2Nc3nonc3NC3=C2C(=O)CC(C)(C)C3)cc1 |
| InChI | InChI=1S/C18H20N4O2/c1-10-4-6-11(7-5-10)15-14-12(8-18(2,3)9-13(14)23)19-16-17(20-15)22-24-21-16/h4-7,15H,8-9H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | NPHBEXQRDHWWEW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |