About N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide
N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide (PubChem CID 135717235) has the molecular formula C15H12Cl2N2O3
and a molecular weight of 339.18 g/mol. Its IUPAC name is N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide.
Molecular Properties
| Compound Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide |
| PubChem CID | 135717235 |
| Molecular Formula | C15H12Cl2N2O3 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide |
| SMILES | C/C(=N\NC(=O)c1ccccc1O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H12Cl2N2O3/c1-8(11-6-9(16)7-12(17)14(11)21)18-19-15(22)10-4-2-3-5-13(10)20/h2-7,20-21H,1H3,(H,19,22)/b18-8+ |
| InChIKey | LJHQYGWMIZIHHB-QGMBQPNBSA-N |
| XLogP | 3.56 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide?
The IUPAC name of N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide (CID 135717235) is N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide.
What is the SMILES notation for N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide?
The canonical SMILES for N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide is C/C(=N\NC(=O)c1ccccc1O)c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide?
The InChIKey is LJHQYGWMIZIHHB-QGMBQPNBSA-N. The full InChI is InChI=1S/C15H12Cl2N2O3/c1-8(11-6-9(16)7-12(17)14(11)21)18-19-15(22)10-4-2-3-5-13(10)20/h2-7,20-21H,1H3,(H,19,22)/b18-8+.
What are the key properties of N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide?
N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide has a molecular weight of 339.18 g/mol, XLogP of 3.56, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-hydroxybenzamide is sourced from PubChem (CID 135717235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).