About 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol
6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol (PubChem CID 135718166) has the molecular formula C13H8BrN3OS
and a molecular weight of 334.20 g/mol. Its IUPAC name is 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol.
Molecular Properties
| Compound Name | 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol |
| PubChem CID | 135718166 |
| Molecular Formula | C13H8BrN3OS |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol |
| SMILES | Oc1ccc2cc(Br)ccc2c1/N=N/c1nccs1 |
| InChI | InChI=1S/C13H8BrN3OS/c14-9-2-3-10-8(7-9)1-4-11(18)12(10)16-17-13-15-5-6-19-13/h1-7,18H/b17-16+ |
| InChIKey | QRBGIICAQIRPSZ-WUKNDPDISA-N |
| XLogP | 5.18 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol?
The IUPAC name of 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol (CID 135718166) is 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol.
What is the SMILES notation for 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol?
The canonical SMILES for 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol is Oc1ccc2cc(Br)ccc2c1/N=N/c1nccs1.
What is the InChIKey of 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol?
The InChIKey is QRBGIICAQIRPSZ-WUKNDPDISA-N. The full InChI is InChI=1S/C13H8BrN3OS/c14-9-2-3-10-8(7-9)1-4-11(18)12(10)16-17-13-15-5-6-19-13/h1-7,18H/b17-16+.
What are the key properties of 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol?
6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol has a molecular weight of 334.20 g/mol, XLogP of 5.18, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-(1,3-thiazol-2-yldiazenyl)naphthalen-2-ol is sourced from PubChem (CID 135718166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).