C32H40F2N4O3Si2 — CID 135718571
2-[[3-(1H-benzimidazol-2-yl)-5-[2,6-difluoro-3-(2-trimethylsilylethoxymethoxy)phenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 135718571) has the molecular formula C32H40F2N4O3Si2 and a molecular weight of 622.87 g/mol. Its IUPAC name is 2-[[3-(1H-benzimidazol-2-yl)-5-[2,6-difluoro-3-(2-trimethylsilylethoxymethoxy)phenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(1H-benzimidazol-2-yl)-5-[2,6-difluoro-3-(2-trimethylsilylethoxymethoxy)phenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 135718571 |
| Molecular Formula | C32H40F2N4O3Si2 |
| Molecular Weight | 622.87 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | 2-[[3-(1H-benzimidazol-2-yl)-5-[2,6-difluoro-3-(2-trimethylsilylethoxymethoxy)phenyl]indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCOc1ccc(F)c(-c2ccc3c(c2)c(-c2nc4ccccc4[nH]2)nn3COCC[Si](C)(C)C)c1F |
| InChI | InChI=1S/C32H40F2N4O3Si2/c1-42(2,3)17-15-39-20-38-27-13-11-22(19-23(27)31(37-38)32-35-25-9-7-8-10-26(25)36-32)29-24(33)12-14-28(30(29)34)41-21-40-16-18-43(4,5)6/h7-14,19H,15-18,20-21H2,1-6H3,(H,35,36) |
| InChIKey | WUSGWSXLBYLTCC-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.87 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|