C26H37BN4O3Si — CID 135718579
2-[[3-(6,7-dihydro-1H-benzimidazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 135718579) has the molecular formula C26H37BN4O3Si and a molecular weight of 492.51 g/mol. Its IUPAC name is 2-[[3-(6,7-dihydro-1H-benzimidazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(6,7-dihydro-1H-benzimidazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 135718579 |
| Molecular Formula | C26H37BN4O3Si |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 2-[[3-(6,7-dihydro-1H-benzimidazol-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC1(C)OB(c2ccc3c(c2)c(-c2nc4c([nH]2)CCC=C4)nn3COCC[Si](C)(C)C)OC1(C)C |
| InChI | InChI=1S/C26H37BN4O3Si/c1-25(2)26(3,4)34-27(33-25)18-12-13-22-19(16-18)23(24-28-20-10-8-9-11-21(20)29-24)30-31(22)17-32-14-15-35(5,6)7/h8,10,12-13,16H,9,11,14-15,17H2,1-7H3,(H,28,29) |
| InChIKey | ACOOQMUFTAPENB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|