C20H28N4O2 — CID 135719711
6-[[4-(diethylamino)-2-methoxyphenyl]methyl]-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135719711) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 6-[[4-(diethylamino)-2-methoxyphenyl]methyl]-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[4-(diethylamino)-2-methoxyphenyl]methyl]-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135719711 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 6-[[4-(diethylamino)-2-methoxyphenyl]methyl]-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCN(CC)c1ccc(CN2CCc3nc(C)[nH]c(=O)c3C2)c(OC)c1 |
| InChI | InChI=1S/C20H28N4O2/c1-5-24(6-2)16-8-7-15(19(11-16)26-4)12-23-10-9-18-17(13-23)20(25)22-14(3)21-18/h7-8,11H,5-6,9-10,12-13H2,1-4H3,(H,21,22,25) |
| InChIKey | XOLTUTHCYWAOAS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|