C16H15N2O2S- — CID 135720505
[4-(2-methyl-3,5-dihydro-2H-1,5-benzothiazepin-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dioxidoazanium (PubChem CID 135720505) has the molecular formula C16H15N2O2S- and a molecular weight of 299.38 g/mol. Its IUPAC name is [4-(2-methyl-3,5-dihydro-2H-1,5-benzothiazepin-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dioxidoazanium.
| Compound Name | [4-(2-methyl-3,5-dihydro-2H-1,5-benzothiazepin-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dioxidoazanium |
|---|---|
| PubChem CID | 135720505 |
| Molecular Formula | C16H15N2O2S- |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | [4-(2-methyl-3,5-dihydro-2H-1,5-benzothiazepin-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dioxidoazanium |
| SMILES | CC1CC(=C2C=CC(=[N+]([O-])[O-])C=C2)Nc2ccccc2S1 |
| InChI | InChI=1S/C16H15N2O2S/c1-11-10-15(12-6-8-13(9-7-12)18(19)20)17-14-4-2-3-5-16(14)21-11/h2-9,11,17H,10H2,1H3/q-1 |
| InChIKey | LGWUIPZXPVUHBF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|