C21H22N2O3 — CID 135721563
(2R)-2-[4-(3-hydroxy-5-imino-4-phenyl-2H-pyrrol-1-yl)phenyl]-3-methylbutanoic acid (PubChem CID 135721563) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2R)-2-[4-(3-hydroxy-5-imino-4-phenyl-2H-pyrrol-1-yl)phenyl]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[4-(3-hydroxy-5-imino-4-phenyl-2H-pyrrol-1-yl)phenyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 135721563 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (2R)-2-[4-(3-hydroxy-5-imino-4-phenyl-2H-pyrrol-1-yl)phenyl]-3-methylbutanoic acid |
| SMILES | [H]/N=C1/C(c2ccccc2)=C(O)CN1c1ccc([C@H](C(=O)O)C(C)C)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-13(2)18(21(25)26)15-8-10-16(11-9-15)23-12-17(24)19(20(23)22)14-6-4-3-5-7-14/h3-11,13,18,22,24H,12H2,1-2H3,(H,25,26)/b22-20-/t18-/m1/s1 |
| InChIKey | PJWMNBIYBCVJLS-ZBKJMMEJSA-N |
| XLogP | 4.28 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|