C29H25NO13 — CID 135721732
2-(dimethylamino)ethyl 6-[2-(5,8-dihydroxy-7-methoxy-4,9-dioxobenzo[f][1]benzofuran-2-yl)-1-hydroxyethyl]-7,8-dihydroxy-1-oxoisochromene-3-carboxylate (PubChem CID 135721732) has the molecular formula C29H25NO13 and a molecular weight of 595.51 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 6-[2-(5,8-dihydroxy-7-methoxy-4,9-dioxobenzo[f][1]benzofuran-2-yl)-1-hydroxyethyl]-7,8-dihydroxy-1-oxoisochromene-3-carboxylate.
| Compound Name | 2-(dimethylamino)ethyl 6-[2-(5,8-dihydroxy-7-methoxy-4,9-dioxobenzo[f][1]benzofuran-2-yl)-1-hydroxyethyl]-7,8-dihydroxy-1-oxoisochromene-3-carboxylate |
|---|---|
| PubChem CID | 135721732 |
| Molecular Formula | C29H25NO13 |
| Molecular Weight | 595.51 g/mol |
| Exact Mass | 595.13 |
| IUPAC Name | 2-(dimethylamino)ethyl 6-[2-(5,8-dihydroxy-7-methoxy-4,9-dioxobenzo[f][1]benzofuran-2-yl)-1-hydroxyethyl]-7,8-dihydroxy-1-oxoisochromene-3-carboxylate |
| SMILES | COc1cc(O)c2c(c1O)C(=O)c1oc(CC(O)c3cc4cc(C(=O)OCCN(C)C)oc(=O)c4c(O)c3O)cc1C2=O |
| InChI | InChI=1S/C29H25NO13/c1-30(2)4-5-41-28(38)18-7-11-6-13(23(34)25(36)19(11)29(39)43-18)15(31)9-12-8-14-22(33)20-16(32)10-17(40-3)24(35)21(20)26(37)27(14)42-12/h6-8,10,15,31-32,34-36H,4-5,9H2,1-3H3 |
| InChIKey | FWSRVDDWSJPTMT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 217.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|