C26H46O8Si — CID 135721793
2-O-tert-butyl 1-O-ethyl 4-O-[(2R,3S)-3-methyl-4-oxobutan-2-yl] (Z,3R)-3-[diethyl(propan-2-yl)silyl]oxy-1-methylbut-1-ene-1,2,4-tricarboxylate (PubChem CID 135721793) has the molecular formula C26H46O8Si and a molecular weight of 514.73 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-ethyl 4-O-[(2R,3S)-3-methyl-4-oxobutan-2-yl] (Z,3R)-3-[diethyl(propan-2-yl)silyl]oxy-1-methylbut-1-ene-1,2,4-tricarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-ethyl 4-O-[(2R,3S)-3-methyl-4-oxobutan-2-yl] (Z,3R)-3-[diethyl(propan-2-yl)silyl]oxy-1-methylbut-1-ene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 135721793 |
| Molecular Formula | C26H46O8Si |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | 2-O-tert-butyl 1-O-ethyl 4-O-[(2R,3S)-3-methyl-4-oxobutan-2-yl] (Z,3R)-3-[diethyl(propan-2-yl)silyl]oxy-1-methylbut-1-ene-1,2,4-tricarboxylate |
| SMILES | CCOC(=O)/C(C)=C(\C(=O)OC(C)(C)C)[C@@H](CC(=O)O[C@H](C)[C@H](C)C=O)O[Si](CC)(CC)C(C)C |
| InChI | InChI=1S/C26H46O8Si/c1-12-31-24(29)19(7)23(25(30)33-26(9,10)11)21(34-35(13-2,14-3)17(4)5)15-22(28)32-20(8)18(6)16-27/h16-18,20-21H,12-15H2,1-11H3/b23-19-/t18-,20-,21-/m1/s1 |
| InChIKey | UKZWFWFDQAAAQL-CULAVBRGSA-N |
| XLogP | 5.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|