About 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one
4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one (PubChem CID 135721853) has the molecular formula C11H12O6
and a molecular weight of 240.21 g/mol. Its IUPAC name is 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one.
Molecular Properties
| Compound Name | 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one |
| PubChem CID | 135721853 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one |
| SMILES | CCC(=O)c1c(O)oc(=O)c(C(=O)CC)c1O |
| InChI | InChI=1S/C11H12O6/c1-3-5(12)7-9(14)8(6(13)4-2)11(16)17-10(7)15/h14-15H,3-4H2,1-2H3 |
| InChIKey | YROCUOOAEFQNEZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one?
The IUPAC name of 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one (CID 135721853) is 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one.
What is the SMILES notation for 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one?
The canonical SMILES for 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one is CCC(=O)c1c(O)oc(=O)c(C(=O)CC)c1O.
What is the InChIKey of 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one?
The InChIKey is YROCUOOAEFQNEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O6/c1-3-5(12)7-9(14)8(6(13)4-2)11(16)17-10(7)15/h14-15H,3-4H2,1-2H3.
What are the key properties of 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one?
4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one has a molecular weight of 240.21 g/mol, XLogP of 1.24, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dihydroxy-3,5-di(propanoyl)pyran-2-one is sourced from PubChem (CID 135721853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).