About 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one
3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one (PubChem CID 135721854) has the molecular formula C17H24O6
and a molecular weight of 324.37 g/mol. Its IUPAC name is 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one.
Molecular Properties
| Compound Name | 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one |
| PubChem CID | 135721854 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one |
| SMILES | CCCCCC(=O)c1c(O)oc(=O)c(C(=O)CCCCC)c1O |
| InChI | InChI=1S/C17H24O6/c1-3-5-7-9-11(18)13-15(20)14(17(22)23-16(13)21)12(19)10-8-6-4-2/h20-21H,3-10H2,1-2H3 |
| InChIKey | NMSJEOMORIBFDZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one?
The IUPAC name of 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one (CID 135721854) is 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one.
What is the SMILES notation for 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one?
The canonical SMILES for 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one is CCCCCC(=O)c1c(O)oc(=O)c(C(=O)CCCCC)c1O.
What is the InChIKey of 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one?
The InChIKey is NMSJEOMORIBFDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O6/c1-3-5-7-9-11(18)13-15(20)14(17(22)23-16(13)21)12(19)10-8-6-4-2/h20-21H,3-10H2,1-2H3.
What are the key properties of 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one?
3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one has a molecular weight of 324.37 g/mol, XLogP of 3.58, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-di(hexanoyl)-4,6-dihydroxypyran-2-one is sourced from PubChem (CID 135721854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).