About pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate
pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate (PubChem CID 135723243) has the molecular formula C15H17N2O4+
and a molecular weight of 289.31 g/mol. Its IUPAC name is pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate |
| PubChem CID | 135723243 |
| Molecular Formula | C15H17N2O4+ |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate |
| SMILES | C=CCC(C)OC(=O)C1=C[CH+]C=C/C1=N\N=CC(=O)OC |
| InChI | InChI=1S/C15H17N2O4/c1-4-7-11(2)21-15(19)12-8-5-6-9-13(12)17-16-10-14(18)20-3/h4-6,8-11H,1,7H2,2-3H3/q+1/b16-10?,17-13+ |
| InChIKey | CRQRIEKCGGUQMM-IMWDWCNJSA-N |
| XLogP | 1.79 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate?
The IUPAC name of pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate (CID 135723243) is pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate.
What is the SMILES notation for pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate?
The canonical SMILES for pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate is C=CCC(C)OC(=O)C1=C[CH+]C=C/C1=N\N=CC(=O)OC.
What is the InChIKey of pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate?
The InChIKey is CRQRIEKCGGUQMM-IMWDWCNJSA-N. The full InChI is InChI=1S/C15H17N2O4/c1-4-7-11(2)21-15(19)12-8-5-6-9-13(12)17-16-10-14(18)20-3/h4-6,8-11H,1,7H2,2-3H3/q+1/b16-10?,17-13+.
What are the key properties of pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate?
pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate has a molecular weight of 289.31 g/mol, XLogP of 1.79, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-en-2-yl (6E)-6-[(2-methoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate is sourced from PubChem (CID 135723243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).