About (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one
(3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one (PubChem CID 135723783) has the molecular formula C22H15ClN2O
and a molecular weight of 358.83 g/mol. Its IUPAC name is (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one |
| PubChem CID | 135723783 |
| Molecular Formula | C22H15ClN2O |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C(c2ccccc2)=N/C1=C\c1ccccc1 |
| InChI | InChI=1S/C22H15ClN2O/c23-17-11-12-19-18(14-17)21(16-9-5-2-6-10-16)24-20(22(26)25-19)13-15-7-3-1-4-8-15/h1-14H,(H,25,26)/b20-13- |
| InChIKey | AEQAYPPMLMNRJC-MOSHPQCFSA-N |
| XLogP | 5.17 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one?
The IUPAC name of (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one (CID 135723783) is (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one.
What is the SMILES notation for (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one?
The canonical SMILES for (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one is O=C1Nc2ccc(Cl)cc2C(c2ccccc2)=N/C1=C\c1ccccc1.
What is the InChIKey of (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one?
The InChIKey is AEQAYPPMLMNRJC-MOSHPQCFSA-N. The full InChI is InChI=1S/C22H15ClN2O/c23-17-11-12-19-18(14-17)21(16-9-5-2-6-10-16)24-20(22(26)25-19)13-15-7-3-1-4-8-15/h1-14H,(H,25,26)/b20-13-.
What are the key properties of (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one?
(3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one has a molecular weight of 358.83 g/mol, XLogP of 5.17, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-benzylidene-7-chloro-5-phenyl-1H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 135723783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).