C21H28N6O — CID 135723935
(4E)-4-[[4-(diethylaminomethyl)-5-methyl-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrimidin-4-yl-1H-pyrazol-5-one (PubChem CID 135723935) has the molecular formula C21H28N6O and a molecular weight of 380.50 g/mol. Its IUPAC name is (4E)-4-[[4-(diethylaminomethyl)-5-methyl-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrimidin-4-yl-1H-pyrazol-5-one.
| Compound Name | (4E)-4-[[4-(diethylaminomethyl)-5-methyl-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrimidin-4-yl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135723935 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | (4E)-4-[[4-(diethylaminomethyl)-5-methyl-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyrimidin-4-yl-1H-pyrazol-5-one |
| SMILES | CCN(CC)Cc1c(C)[nH]c(/C=C2/C(=O)NN=C2c2ccncn2)c1C(C)C |
| InChI | InChI=1S/C21H28N6O/c1-6-27(7-2)11-16-14(5)24-18(19(16)13(3)4)10-15-20(25-26-21(15)28)17-8-9-22-12-23-17/h8-10,12-13,24H,6-7,11H2,1-5H3,(H,26,28)/b15-10+ |
| InChIKey | XVEWZFCUQWCQDG-XNTDXEJSSA-N |
| XLogP | 3.00 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|