C20H26N6O — CID 135723949
(4E)-4-[[4-[2-(diethylamino)ethyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyrimidin-4-yl-1H-pyrazol-5-one (PubChem CID 135723949) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is (4E)-4-[[4-[2-(diethylamino)ethyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyrimidin-4-yl-1H-pyrazol-5-one.
| Compound Name | (4E)-4-[[4-[2-(diethylamino)ethyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyrimidin-4-yl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135723949 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (4E)-4-[[4-[2-(diethylamino)ethyl]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-3-pyrimidin-4-yl-1H-pyrazol-5-one |
| SMILES | CCN(CC)CCc1c(C)[nH]c(/C=C2/C(=O)NN=C2c2ccncn2)c1C |
| InChI | InChI=1S/C20H26N6O/c1-5-26(6-2)10-8-15-13(3)18(23-14(15)4)11-16-19(24-25-20(16)27)17-7-9-21-12-22-17/h7,9,11-12,23H,5-6,8,10H2,1-4H3,(H,25,27)/b16-11+ |
| InChIKey | VGDLFXBQYLCUJH-LFIBNONCSA-N |
| XLogP | 2.22 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|