C22H30N6O — CID 135723981
(4E)-4-[[4-[4-(dimethylamino)butyl]-5-methyl-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-3-yl-1H-pyrazol-5-one (PubChem CID 135723981) has the molecular formula C22H30N6O and a molecular weight of 394.52 g/mol. Its IUPAC name is (4E)-4-[[4-[4-(dimethylamino)butyl]-5-methyl-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-3-yl-1H-pyrazol-5-one.
| Compound Name | (4E)-4-[[4-[4-(dimethylamino)butyl]-5-methyl-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-3-yl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135723981 |
| Molecular Formula | C22H30N6O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (4E)-4-[[4-[4-(dimethylamino)butyl]-5-methyl-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-pyridazin-3-yl-1H-pyrazol-5-one |
| SMILES | Cc1[nH]c(/C=C2/C(=O)NN=C2c2cccnn2)c(C(C)C)c1CCCCN(C)C |
| InChI | InChI=1S/C22H30N6O/c1-14(2)20-16(9-6-7-12-28(4)5)15(3)24-19(20)13-17-21(26-27-22(17)29)18-10-8-11-23-25-18/h8,10-11,13-14,24H,6-7,9,12H2,1-5H3,(H,27,29)/b17-13+ |
| InChIKey | JPTCELWOPMDWCO-GHRIWEEISA-N |
| XLogP | 3.04 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|