C21H22N8O — CID 135724019
(4E)-4-[[3,5-dimethyl-4-[2-[methyl(pyridin-4-yl)amino]ethyl]-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one (PubChem CID 135724019) has the molecular formula C21H22N8O and a molecular weight of 402.46 g/mol. Its IUPAC name is (4E)-4-[[3,5-dimethyl-4-[2-[methyl(pyridin-4-yl)amino]ethyl]-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one.
| Compound Name | (4E)-4-[[3,5-dimethyl-4-[2-[methyl(pyridin-4-yl)amino]ethyl]-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135724019 |
| Molecular Formula | C21H22N8O |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (4E)-4-[[3,5-dimethyl-4-[2-[methyl(pyridin-4-yl)amino]ethyl]-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one |
| SMILES | Cc1[nH]c(/C=C2/C(=O)NN=C2c2nccnn2)c(C)c1CCN(C)c1ccncc1 |
| InChI | InChI=1S/C21H22N8O/c1-13-16(6-11-29(3)15-4-7-22-8-5-15)14(2)25-18(13)12-17-19(26-28-21(17)30)20-23-9-10-24-27-20/h4-5,7-10,12,25H,6,11H2,1-3H3,(H,28,30)/b17-12+ |
| InChIKey | JJRRYQRXNCAQJS-SFQUDFHCSA-N |
| XLogP | 1.81 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|