C24H33N7O — CID 135724121
(4E)-4-[[5-methyl-4-(4-piperidin-1-ylbutyl)-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one (PubChem CID 135724121) has the molecular formula C24H33N7O and a molecular weight of 435.58 g/mol. Its IUPAC name is (4E)-4-[[5-methyl-4-(4-piperidin-1-ylbutyl)-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one.
| Compound Name | (4E)-4-[[5-methyl-4-(4-piperidin-1-ylbutyl)-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135724121 |
| Molecular Formula | C24H33N7O |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | (4E)-4-[[5-methyl-4-(4-piperidin-1-ylbutyl)-3-propan-2-yl-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one |
| SMILES | Cc1[nH]c(/C=C2/C(=O)NN=C2c2nccnn2)c(C(C)C)c1CCCCN1CCCCC1 |
| InChI | InChI=1S/C24H33N7O/c1-16(2)21-18(9-5-8-14-31-12-6-4-7-13-31)17(3)27-20(21)15-19-22(28-30-24(19)32)23-25-10-11-26-29-23/h10-11,15-16,27H,4-9,12-14H2,1-3H3,(H,30,32)/b19-15+ |
| InChIKey | UOPNVUDQTIRLLL-XDJHFCHBSA-N |
| XLogP | 3.36 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|