C17H15F3N6O2 — CID 135724130
N-[[2,4-dimethyl-5-[(E)-(5-oxo-3-pyrazin-2-yl-1H-pyrazol-4-ylidene)methyl]-1H-pyrrol-3-yl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 135724130) has the molecular formula C17H15F3N6O2 and a molecular weight of 392.34 g/mol. Its IUPAC name is N-[[2,4-dimethyl-5-[(E)-(5-oxo-3-pyrazin-2-yl-1H-pyrazol-4-ylidene)methyl]-1H-pyrrol-3-yl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[2,4-dimethyl-5-[(E)-(5-oxo-3-pyrazin-2-yl-1H-pyrazol-4-ylidene)methyl]-1H-pyrrol-3-yl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 135724130 |
| Molecular Formula | C17H15F3N6O2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[[2,4-dimethyl-5-[(E)-(5-oxo-3-pyrazin-2-yl-1H-pyrazol-4-ylidene)methyl]-1H-pyrrol-3-yl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | Cc1[nH]c(/C=C2/C(=O)NN=C2c2cnccn2)c(C)c1CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H15F3N6O2/c1-8-11(6-23-16(28)17(18,19)20)9(2)24-12(8)5-10-14(25-26-15(10)27)13-7-21-3-4-22-13/h3-5,7,24H,6H2,1-2H3,(H,23,28)(H,26,27)/b10-5+ |
| InChIKey | AOTJRCYVSVEIDG-BJMVGYQFSA-N |
| XLogP | 1.52 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|