C23H29N7O — CID 135724172
(4E)-4-[[3-cyclopropyl-5-methyl-4-(4-pyrrolidin-1-ylbutyl)-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one (PubChem CID 135724172) has the molecular formula C23H29N7O and a molecular weight of 419.53 g/mol. Its IUPAC name is (4E)-4-[[3-cyclopropyl-5-methyl-4-(4-pyrrolidin-1-ylbutyl)-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one.
| Compound Name | (4E)-4-[[3-cyclopropyl-5-methyl-4-(4-pyrrolidin-1-ylbutyl)-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135724172 |
| Molecular Formula | C23H29N7O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | (4E)-4-[[3-cyclopropyl-5-methyl-4-(4-pyrrolidin-1-ylbutyl)-1H-pyrrol-2-yl]methylidene]-3-(1,2,4-triazin-3-yl)-1H-pyrazol-5-one |
| SMILES | Cc1[nH]c(/C=C2/C(=O)NN=C2c2nccnn2)c(C2CC2)c1CCCCN1CCCC1 |
| InChI | InChI=1S/C23H29N7O/c1-15-17(6-2-3-11-30-12-4-5-13-30)20(16-7-8-16)19(26-15)14-18-21(27-29-23(18)31)22-24-9-10-25-28-22/h9-10,14,16,26H,2-8,11-13H2,1H3,(H,29,31)/b18-14+ |
| InChIKey | KXLWBDULNHJHHC-NBVRZTHBSA-N |
| XLogP | 2.72 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|