C18H20N6O — CID 135724251
(4Z)-4-[[4-(dimethylamino)-4,5,6,7-tetrahydro-1H-indol-2-yl]methylidene]-3-pyridazin-4-yl-1H-pyrazol-5-one (PubChem CID 135724251) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is (4Z)-4-[[4-(dimethylamino)-4,5,6,7-tetrahydro-1H-indol-2-yl]methylidene]-3-pyridazin-4-yl-1H-pyrazol-5-one.
| Compound Name | (4Z)-4-[[4-(dimethylamino)-4,5,6,7-tetrahydro-1H-indol-2-yl]methylidene]-3-pyridazin-4-yl-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 135724251 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (4Z)-4-[[4-(dimethylamino)-4,5,6,7-tetrahydro-1H-indol-2-yl]methylidene]-3-pyridazin-4-yl-1H-pyrazol-5-one |
| SMILES | CN(C)C1CCCc2[nH]c(/C=C3\C(=O)NN=C3c3ccnnc3)cc21 |
| InChI | InChI=1S/C18H20N6O/c1-24(2)16-5-3-4-15-13(16)8-12(21-15)9-14-17(22-23-18(14)25)11-6-7-19-20-10-11/h6-10,16,21H,3-5H2,1-2H3,(H,23,25)/b14-9- |
| InChIKey | LDGHUKMBYMPUCL-ZROIWOOFSA-N |
| XLogP | 1.66 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|