C13H9NO2S — CID 135725006
2-(1,3-benzothiazol-2-yl)benzene-1,4-diol (PubChem CID 135725006) has the molecular formula C13H9NO2S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)benzene-1,4-diol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 135725006 |
| Molecular Formula | C13H9NO2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C13H9NO2S/c15-8-5-6-11(16)9(7-8)13-14-10-3-1-2-4-12(10)17-13/h1-7,15-16H |
| InChIKey | ZIRXAKKIXBASQZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|