About [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate
[(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate (PubChem CID 135725162) has the molecular formula C15H17N2O4+
and a molecular weight of 289.31 g/mol. Its IUPAC name is [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate |
| PubChem CID | 135725162 |
| Molecular Formula | C15H17N2O4+ |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate |
| SMILES | C/C=C/COC(=O)C1=C[CH+]C=C/C1=N\N=CC(=O)OCC |
| InChI | InChI=1S/C15H17N2O4/c1-3-5-10-21-15(19)12-8-6-7-9-13(12)17-16-11-14(18)20-4-2/h3,5-9,11H,4,10H2,1-2H3/q+1/b5-3+,16-11?,17-13+ |
| InChIKey | QTVFZVGCUCMCQY-GMHBHRTESA-N |
| XLogP | 1.80 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate?
The IUPAC name of [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate (CID 135725162) is [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate.
What is the SMILES notation for [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate?
The canonical SMILES for [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate is C/C=C/COC(=O)C1=C[CH+]C=C/C1=N\N=CC(=O)OCC.
What is the InChIKey of [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate?
The InChIKey is QTVFZVGCUCMCQY-GMHBHRTESA-N. The full InChI is InChI=1S/C15H17N2O4/c1-3-5-10-21-15(19)12-8-6-7-9-13(12)17-16-11-14(18)20-4-2/h3,5-9,11H,4,10H2,1-2H3/q+1/b5-3+,16-11?,17-13+.
What are the key properties of [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate?
[(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate has a molecular weight of 289.31 g/mol, XLogP of 1.80, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enyl] (6E)-6-[(2-ethoxy-2-oxoethylidene)hydrazinylidene]cyclohexa-1,4-diene-1-carboxylate is sourced from PubChem (CID 135725162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).