C16H11ClN6O — CID 135726317
2-[(E)-[(8-chloro-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol (PubChem CID 135726317) has the molecular formula C16H11ClN6O and a molecular weight of 338.76 g/mol. Its IUPAC name is 2-[(E)-[(8-chloro-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-[(E)-[(8-chloro-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135726317 |
| Molecular Formula | C16H11ClN6O |
| Molecular Weight | 338.76 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-[(E)-[(8-chloro-5H-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
| SMILES | Oc1ccccc1/C=N/Nc1nnc2c(n1)[nH]c1ccc(Cl)cc12 |
| InChI | InChI=1S/C16H11ClN6O/c17-10-5-6-12-11(7-10)14-15(19-12)20-16(23-21-14)22-18-8-9-3-1-2-4-13(9)24/h1-8,24H,(H2,19,20,22,23)/b18-8+ |
| InChIKey | OLCMHFPQDMDLQR-QGMBQPNBSA-N |
| XLogP | 3.31 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.76 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|