About 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one
2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 135726636) has the molecular formula C11H8N4OS
and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 135726636 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | O=c1[nH]cnc2nc(Nc3ccccc3)sc12 |
| InChI | InChI=1S/C11H8N4OS/c16-10-8-9(12-6-13-10)15-11(17-8)14-7-4-2-1-3-5-7/h1-6H,(H2,12,13,14,15,16) |
| InChIKey | TVYBDNZUZDXQOG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (CID 135726636) is 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one is O=c1[nH]cnc2nc(Nc3ccccc3)sc12.
What is the InChIKey of 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
The InChIKey is TVYBDNZUZDXQOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4OS/c16-10-8-9(12-6-13-10)15-11(17-8)14-7-4-2-1-3-5-7/h1-6H,(H2,12,13,14,15,16).
What are the key properties of 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one has a molecular weight of 244.28 g/mol, XLogP of 2.12, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-anilino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 135726636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).