C12H11N4O3S- — CID 135726791
(2Z)-2-methoxyimino-2-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)acetate (PubChem CID 135726791) has the molecular formula C12H11N4O3S- and a molecular weight of 291.31 g/mol. Its IUPAC name is (2Z)-2-methoxyimino-2-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)acetate.
| Compound Name | (2Z)-2-methoxyimino-2-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)acetate |
|---|---|
| PubChem CID | 135726791 |
| Molecular Formula | C12H11N4O3S- |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | (2Z)-2-methoxyimino-2-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)acetate |
| SMILES | CO/N=C(\C(=O)[O-])C1=NN/C(=N/c2ccccc2)SC1 |
| InChI | InChI=1S/C12H12N4O3S/c1-19-16-10(11(17)18)9-7-20-12(15-14-9)13-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,13,15)(H,17,18)/p-1/b16-10- |
| InChIKey | UZWLVLNXOOFWOM-YBEGLDIGSA-M |
| XLogP | 0.12 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|