C21H19N5O2 — CID 135727343
2-(2,3-dihydroindol-1-yl)-4-(3-hydroxyphenyl)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one (PubChem CID 135727343) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-4-(3-hydroxyphenyl)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-4-(3-hydroxyphenyl)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
|---|---|
| PubChem CID | 135727343 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-4-(3-hydroxyphenyl)-8-methyl-1,4-dihydropyrimido[1,2-a][1,3,5]triazin-6-one |
| SMILES | Cc1cc(=O)n2c(n1)NC(N1CCc3ccccc31)=NC2c1cccc(O)c1 |
| InChI | InChI=1S/C21H19N5O2/c1-13-11-18(28)26-19(15-6-4-7-16(27)12-15)23-20(24-21(26)22-13)25-10-9-14-5-2-3-8-17(14)25/h2-8,11-12,19,27H,9-10H2,1H3,(H,22,23,24) |
| InChIKey | QJUAFCMUDHEEDV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |