C20H22FN3OS — CID 135727957
2-(4-fluorophenyl)-4-[C-methyl-N-(2-thiophen-2-ylethyl)carbonimidoyl]-5-propyl-1H-pyrazol-3-one (PubChem CID 135727957) has the molecular formula C20H22FN3OS and a molecular weight of 371.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[C-methyl-N-(2-thiophen-2-ylethyl)carbonimidoyl]-5-propyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-fluorophenyl)-4-[C-methyl-N-(2-thiophen-2-ylethyl)carbonimidoyl]-5-propyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135727957 |
| Molecular Formula | C20H22FN3OS |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[C-methyl-N-(2-thiophen-2-ylethyl)carbonimidoyl]-5-propyl-1H-pyrazol-3-one |
| SMILES | CCCc1[nH]n(-c2ccc(F)cc2)c(=O)c1/C(C)=N/CCc1cccs1 |
| InChI | InChI=1S/C20H22FN3OS/c1-3-5-18-19(14(2)22-12-11-17-6-4-13-26-17)20(25)24(23-18)16-9-7-15(21)8-10-16/h4,6-10,13,23H,3,5,11-12H2,1-2H3/b22-14+ |
| InChIKey | YGCBBSAMTLNMQH-HYARGMPZSA-N |
| XLogP | 4.37 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|