C23H20N4O4 — CID 135730288
4-[(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-3,6-dioxo-7H-pyrazolo[3,4-b]pyridin-2-yl]benzoic acid (PubChem CID 135730288) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 4-[(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-3,6-dioxo-7H-pyrazolo[3,4-b]pyridin-2-yl]benzoic acid.
| Compound Name | 4-[(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-3,6-dioxo-7H-pyrazolo[3,4-b]pyridin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 135730288 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-[(5Z)-5-[[4-(dimethylamino)phenyl]methylidene]-4-methyl-3,6-dioxo-7H-pyrazolo[3,4-b]pyridin-2-yl]benzoic acid |
| SMILES | Cc1c2c([nH]c(=O)/c1=C\c1ccc(N(C)C)cc1)=NN(c1ccc(C(=O)O)cc1)C2=O |
| InChI | InChI=1S/C23H20N4O4/c1-13-18(12-14-4-8-16(9-5-14)26(2)3)21(28)24-20-19(13)22(29)27(25-20)17-10-6-15(7-11-17)23(30)31/h4-12H,1-3H3,(H,30,31)(H,24,25,28)/b18-12- |
| InChIKey | LZLWFDSZIVQKNS-PDGQHHTCSA-N |
| XLogP | 1.47 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|